C18H21FN2O5S — CID 51939364
methyl 5-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]furan-2-carboxylate (PubChem CID 51939364) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is methyl 5-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 51939364 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | methyl 5-[(1R)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H](C)N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-13(16-7-8-17(26-16)18(22)25-2)20-9-11-21(12-10-20)27(23,24)15-5-3-14(19)4-6-15/h3-8,13H,9-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | GRTIHNNSSWZKDB-CYBMUJFWSA-N |
| XLogP | 2.27 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |