C19H24ClN3O5S — CID 97058728
N-(5-chloro-2-ethylsulfonylphenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 97058728) has the molecular formula C19H24ClN3O5S and a molecular weight of 441.94 g/mol. Its IUPAC name is N-(5-chloro-2-ethylsulfonylphenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-(5-chloro-2-ethylsulfonylphenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 97058728 |
| Molecular Formula | C19H24ClN3O5S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-(5-chloro-2-ethylsulfonylphenyl)-2-[(5S,6S)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(Cl)cc1NC(=O)CN1C(=O)N[C@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C19H24ClN3O5S/c1-3-29(27,28)15-8-7-13(20)10-14(15)21-16(24)11-23-17(25)19(22-18(23)26)9-5-4-6-12(19)2/h7-8,10,12H,3-6,9,11H2,1-2H3,(H,21,24)(H,22,26)/t12-,19-/m0/s1 |
| InChIKey | AYMWCYMPGOMMCH-BUXKBTBVSA-N |
| XLogP | 2.57 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|