C18H19ClN4O — CID 97061470
3-[(1S,2S)-2-(3-chlorophenyl)cyclopropyl]-1-methyl-1-[(1-prop-2-ynylpyrazol-4-yl)methyl]urea (PubChem CID 97061470) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is 3-[(1S,2S)-2-(3-chlorophenyl)cyclopropyl]-1-methyl-1-[(1-prop-2-ynylpyrazol-4-yl)methyl]urea.
| Compound Name | 3-[(1S,2S)-2-(3-chlorophenyl)cyclopropyl]-1-methyl-1-[(1-prop-2-ynylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 97061470 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 3-[(1S,2S)-2-(3-chlorophenyl)cyclopropyl]-1-methyl-1-[(1-prop-2-ynylpyrazol-4-yl)methyl]urea |
| SMILES | C#CCn1cc(CN(C)C(=O)N[C@H]2C[C@H]2c2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C18H19ClN4O/c1-3-7-23-12-13(10-20-23)11-22(2)18(24)21-17-9-16(17)14-5-4-6-15(19)8-14/h1,4-6,8,10,12,16-17H,7,9,11H2,2H3,(H,21,24)/t16-,17-/m0/s1 |
| InChIKey | JPEVDOCIDBIFTQ-IRXDYDNUSA-N |
| XLogP | 2.87 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|