C16H17N3O3S — CID 97063717
(3S)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide (PubChem CID 97063717) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is (3S)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide.
| Compound Name | (3S)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97063717 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (3S)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-6-oxopiperidine-3-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=O)[C@H]3CCC(=O)NC3)n2)cc1 |
| InChI | InChI=1S/C16H17N3O3S/c1-22-12-5-2-10(3-6-12)13-9-23-16(18-13)19-15(21)11-4-7-14(20)17-8-11/h2-3,5-6,9,11H,4,7-8H2,1H3,(H,17,20)(H,18,19,21)/t11-/m0/s1 |
| InChIKey | NCOQIZHBWMDYQJ-NSHDSACASA-N |
| XLogP | 2.28 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |