C18H24N2O4S — CID 97063830
N-(3-cyclopentyloxy-4-methoxyphenyl)-2-oxo-2-thiomorpholin-4-ylacetamide (PubChem CID 97063830) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-(3-cyclopentyloxy-4-methoxyphenyl)-2-oxo-2-thiomorpholin-4-ylacetamide.
| Compound Name | N-(3-cyclopentyloxy-4-methoxyphenyl)-2-oxo-2-thiomorpholin-4-ylacetamide |
|---|---|
| PubChem CID | 97063830 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-(3-cyclopentyloxy-4-methoxyphenyl)-2-oxo-2-thiomorpholin-4-ylacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)N2CCSCC2)cc1OC1CCCC1 |
| InChI | InChI=1S/C18H24N2O4S/c1-23-15-7-6-13(12-16(15)24-14-4-2-3-5-14)19-17(21)18(22)20-8-10-25-11-9-20/h6-7,12,14H,2-5,8-11H2,1H3,(H,19,21) |
| InChIKey | APMUUHZQFKPEFV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|