About [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate
[(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate (PubChem CID 97066298) has the molecular formula C12H13F3O4
and a molecular weight of 278.23 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate |
| PubChem CID | 97066298 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)O[C@@H]([C@H]1CCCO1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O4/c1-7-8(4-6-17-7)11(16)19-10(12(13,14)15)9-3-2-5-18-9/h4,6,9-10H,2-3,5H2,1H3/t9-,10+/m1/s1 |
| InChIKey | LGYKFEUCZNCRQF-ZJUUUORDSA-N |
| XLogP | 2.85 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate?
The IUPAC name of [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate (CID 97066298) is [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate.
What is the SMILES notation for [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate?
The canonical SMILES for [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate is Cc1occc1C(=O)O[C@@H]([C@H]1CCCO1)C(F)(F)F.
What is the InChIKey of [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate?
The InChIKey is LGYKFEUCZNCRQF-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H13F3O4/c1-7-8(4-6-17-7)11(16)19-10(12(13,14)15)9-3-2-5-18-9/h4,6,9-10H,2-3,5H2,1H3/t9-,10+/m1/s1.
What are the key properties of [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate?
[(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate has a molecular weight of 278.23 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2,2-trifluoro-1-[(2R)-oxolan-2-yl]ethyl] 2-methylfuran-3-carboxylate is sourced from PubChem (CID 97066298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).