C7H8F6O4S — CID 98124524
[(1S)-2,2,2-trifluoro-1-[(2S)-oxolan-2-yl]ethyl] trifluoromethanesulfonate (PubChem CID 98124524) has the molecular formula C7H8F6O4S and a molecular weight of 302.19 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-[(2S)-oxolan-2-yl]ethyl] trifluoromethanesulfonate.
| Compound Name | [(1S)-2,2,2-trifluoro-1-[(2S)-oxolan-2-yl]ethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 98124524 |
| Molecular Formula | C7H8F6O4S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-[(2S)-oxolan-2-yl]ethyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@@H]([C@@H]1CCCO1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6O4S/c8-6(9,10)5(4-2-1-3-16-4)17-18(14,15)7(11,12)13/h4-5H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | LURXFUQBTOVEFW-WHFBIAKZSA-N |
| XLogP | 1.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|