C21H38N4O2 — CID 97066394
tert-butyl (2S)-2-[(2S)-2-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]propyl]azepane-1-carboxylate (PubChem CID 97066394) has the molecular formula C21H38N4O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2S)-2-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]propyl]azepane-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2S)-2-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]propyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 97066394 |
| Molecular Formula | C21H38N4O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | tert-butyl (2S)-2-[(2S)-2-[3-(5-methyl-1H-pyrazol-4-yl)propylamino]propyl]azepane-1-carboxylate |
| SMILES | Cc1[nH]ncc1CCCN[C@@H](C)C[C@@H]1CCCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38N4O2/c1-16(22-12-9-10-18-15-23-24-17(18)2)14-19-11-7-6-8-13-25(19)20(26)27-21(3,4)5/h15-16,19,22H,6-14H2,1-5H3,(H,23,24)/t16-,19-/m0/s1 |
| InChIKey | YYHRZSGPILKHLO-LPHOPBHVSA-N |
| XLogP | 4.20 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|