C18H25ClN4O — CID 97066602
(2S)-2-(3-chlorophenyl)-N-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]-2-morpholin-4-ylethanamine (PubChem CID 97066602) has the molecular formula C18H25ClN4O and a molecular weight of 348.88 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-N-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]-2-morpholin-4-ylethanamine.
| Compound Name | (2S)-2-(3-chlorophenyl)-N-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 97066602 |
| Molecular Formula | C18H25ClN4O |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-N-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]-2-morpholin-4-ylethanamine |
| SMILES | C[C@@H](NC[C@H](c1cccc(Cl)c1)N1CCOCC1)c1cnn(C)c1 |
| InChI | InChI=1S/C18H25ClN4O/c1-14(16-11-21-22(2)13-16)20-12-18(23-6-8-24-9-7-23)15-4-3-5-17(19)10-15/h3-5,10-11,13-14,18,20H,6-9,12H2,1-2H3/t14-,18-/m1/s1 |
| InChIKey | CETXYDFTGWVLGM-RDTXWAMCSA-N |
| XLogP | 2.80 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |