C17H23ClN4O — CID 97226783
(2R)-2-(3-chlorophenyl)-2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]ethanol (PubChem CID 97226783) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenyl)-2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]ethanol.
| Compound Name | (2R)-2-(3-chlorophenyl)-2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 97226783 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2R)-2-(3-chlorophenyl)-2-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]ethanol |
| SMILES | Cn1cc(CN2CCN([C@@H](CO)c3cccc(Cl)c3)CC2)cn1 |
| InChI | InChI=1S/C17H23ClN4O/c1-20-11-14(10-19-20)12-21-5-7-22(8-6-21)17(13-23)15-3-2-4-16(18)9-15/h2-4,9-11,17,23H,5-8,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | BFOWBLIKJBANEY-KRWDZBQOSA-N |
| XLogP | 1.92 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |