C15H18BrN3 — CID 97066688
3-(3-bromophenyl)-N-[(1S)-1-pyrazin-2-ylethyl]propan-1-amine (PubChem CID 97066688) has the molecular formula C15H18BrN3 and a molecular weight of 320.23 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-[(1S)-1-pyrazin-2-ylethyl]propan-1-amine.
| Compound Name | 3-(3-bromophenyl)-N-[(1S)-1-pyrazin-2-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 97066688 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-(3-bromophenyl)-N-[(1S)-1-pyrazin-2-ylethyl]propan-1-amine |
| SMILES | C[C@H](NCCCc1cccc(Br)c1)c1cnccn1 |
| InChI | InChI=1S/C15H18BrN3/c1-12(15-11-17-8-9-19-15)18-7-3-5-13-4-2-6-14(16)10-13/h2,4,6,8-12,18H,3,5,7H2,1H3/t12-/m0/s1 |
| InChIKey | ZQODFQIXOSKPBW-LBPRGKRZSA-N |
| XLogP | 3.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|