C13H19FN4O — CID 97069457
5-fluoro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyrimidin-2-amine (PubChem CID 97069457) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-fluoro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 97069457 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-fluoro-N-[1-[(3R)-oxolan-3-yl]piperidin-4-yl]pyrimidin-2-amine |
| SMILES | Fc1cnc(NC2CCN([C@@H]3CCOC3)CC2)nc1 |
| InChI | InChI=1S/C13H19FN4O/c14-10-7-15-13(16-8-10)17-11-1-4-18(5-2-11)12-3-6-19-9-12/h7-8,11-12H,1-6,9H2,(H,15,16,17)/t12-/m1/s1 |
| InChIKey | WPDCIIHHTGWIBO-GFCCVEGCSA-N |
| XLogP | 1.28 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |