About [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone
[4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone (PubChem CID 97069676) has the molecular formula C18H24N4O2
and a molecular weight of 328.42 g/mol. Its IUPAC name is [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone.
Molecular Properties
| Compound Name | [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone |
| PubChem CID | 97069676 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN([C@@H]3CCC[C@H]3O)CC2)c2[nH]ncc2c1 |
| InChI | InChI=1S/C18H24N4O2/c1-12-9-13-11-19-20-17(13)14(10-12)18(24)22-7-5-21(6-8-22)15-3-2-4-16(15)23/h9-11,15-16,23H,2-8H2,1H3,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | YGDHRMAFAFDZQY-HZPDHXFCSA-N |
| XLogP | 1.54 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone?
The IUPAC name of [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone (CID 97069676) is [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone.
What is the SMILES notation for [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone?
The canonical SMILES for [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone is Cc1cc(C(=O)N2CCN([C@@H]3CCC[C@H]3O)CC2)c2[nH]ncc2c1.
What is the InChIKey of [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone?
The InChIKey is YGDHRMAFAFDZQY-HZPDHXFCSA-N. The full InChI is InChI=1S/C18H24N4O2/c1-12-9-13-11-19-20-17(13)14(10-12)18(24)22-7-5-21(6-8-22)15-3-2-4-16(15)23/h9-11,15-16,23H,2-8H2,1H3,(H,19,20)/t15-,16-/m1/s1.
What are the key properties of [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone?
[4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone has a molecular weight of 328.42 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1R,2R)-2-hydroxycyclopentyl]piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone is sourced from PubChem (CID 97069676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).