C19H19ClN4O — CID 120739788
[2-(2-chlorophenyl)piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone (PubChem CID 120739788) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is [2-(2-chlorophenyl)piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone.
| Compound Name | [2-(2-chlorophenyl)piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone |
|---|---|
| PubChem CID | 120739788 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-(2-chlorophenyl)piperazin-1-yl]-(5-methyl-1H-indazol-7-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCNCC2c2ccccc2Cl)c2[nH]ncc2c1 |
| InChI | InChI=1S/C19H19ClN4O/c1-12-8-13-10-22-23-18(13)15(9-12)19(25)24-7-6-21-11-17(24)14-4-2-3-5-16(14)20/h2-5,8-10,17,21H,6-7,11H2,1H3,(H,22,23) |
| InChIKey | SQIOVWBWBYOQBC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |