C12H24N2O3S — CID 97069973
(2S)-N-cyclopentyl-2-(methanesulfonamido)-3,3-dimethylbutanamide (PubChem CID 97069973) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-(methanesulfonamido)-3,3-dimethylbutanamide.
| Compound Name | (2S)-N-cyclopentyl-2-(methanesulfonamido)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 97069973 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (2S)-N-cyclopentyl-2-(methanesulfonamido)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](NS(C)(=O)=O)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H24N2O3S/c1-12(2,3)10(14-18(4,16)17)11(15)13-9-7-5-6-8-9/h9-10,14H,5-8H2,1-4H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | JRCLOMYGJGQZNE-SNVBAGLBSA-N |
| XLogP | 1.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |