C20H21N7O3S — CID 97070699
N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 97070699) has the molecular formula C20H21N7O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 97070699 |
| Molecular Formula | C20H21N7O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-2-(4-methoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(-c2nc(C(=O)N[C@@H](c3nc(-c4ncn[nH]4)no3)C(C)(C)C)cs2)cc1 |
| InChI | InChI=1S/C20H21N7O3S/c1-20(2,3)14(18-25-16(27-30-18)15-21-10-22-26-15)24-17(28)13-9-31-19(23-13)11-5-7-12(29-4)8-6-11/h5-10,14H,1-4H3,(H,24,28)(H,21,22,26)/t14-/m0/s1 |
| InChIKey | CWFAZULDNRFEJI-AWEZNQCLSA-N |
| XLogP | 3.50 |
| TPSA | 131.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |