C15H17N3O3 — CID 97071148
[(2S)-1-(6-methylpyridazin-3-yl)pyrrolidin-2-yl]methyl furan-3-carboxylate (PubChem CID 97071148) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is [(2S)-1-(6-methylpyridazin-3-yl)pyrrolidin-2-yl]methyl furan-3-carboxylate.
| Compound Name | [(2S)-1-(6-methylpyridazin-3-yl)pyrrolidin-2-yl]methyl furan-3-carboxylate |
|---|---|
| PubChem CID | 97071148 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [(2S)-1-(6-methylpyridazin-3-yl)pyrrolidin-2-yl]methyl furan-3-carboxylate |
| SMILES | Cc1ccc(N2CCC[C@H]2COC(=O)c2ccoc2)nn1 |
| InChI | InChI=1S/C15H17N3O3/c1-11-4-5-14(17-16-11)18-7-2-3-13(18)10-21-15(19)12-6-8-20-9-12/h4-6,8-9,13H,2-3,7,10H2,1H3/t13-/m0/s1 |
| InChIKey | TZAAWODRANEZNK-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |