C17H16N2O6 — CID 96501843
[(2S)-1-(2-nitrobenzoyl)pyrrolidin-2-yl]methyl furan-3-carboxylate (PubChem CID 96501843) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is [(2S)-1-(2-nitrobenzoyl)pyrrolidin-2-yl]methyl furan-3-carboxylate.
| Compound Name | [(2S)-1-(2-nitrobenzoyl)pyrrolidin-2-yl]methyl furan-3-carboxylate |
|---|---|
| PubChem CID | 96501843 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [(2S)-1-(2-nitrobenzoyl)pyrrolidin-2-yl]methyl furan-3-carboxylate |
| SMILES | O=C(OC[C@@H]1CCCN1C(=O)c1ccccc1[N+](=O)[O-])c1ccoc1 |
| InChI | InChI=1S/C17H16N2O6/c20-16(14-5-1-2-6-15(14)19(22)23)18-8-3-4-13(18)11-25-17(21)12-7-9-24-10-12/h1-2,5-7,9-10,13H,3-4,8,11H2/t13-/m0/s1 |
| InChIKey | UHBLMEJYRHMKOD-ZDUSSCGKSA-N |
| XLogP | 2.65 |
| TPSA | 102.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|