C24H23N5O2 — CID 97071722
6-[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2-phenylpyridazin-3-one (PubChem CID 97071722) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 6-[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2-phenylpyridazin-3-one.
| Compound Name | 6-[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 97071722 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 6-[(3S)-3-(6-methyl-1H-benzimidazol-2-yl)piperidine-1-carbonyl]-2-phenylpyridazin-3-one |
| SMILES | Cc1ccc2nc([C@H]3CCCN(C(=O)c4ccc(=O)n(-c5ccccc5)n4)C3)[nH]c2c1 |
| InChI | InChI=1S/C24H23N5O2/c1-16-9-10-19-21(14-16)26-23(25-19)17-6-5-13-28(15-17)24(31)20-11-12-22(30)29(27-20)18-7-3-2-4-8-18/h2-4,7-12,14,17H,5-6,13,15H2,1H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | AGJOWTAMZZFNBE-KRWDZBQOSA-N |
| XLogP | 3.44 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |