C14H26F3N3O — CID 97071735
(3S)-N-[2-(tert-butylamino)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 97071735) has the molecular formula C14H26F3N3O and a molecular weight of 309.38 g/mol. Its IUPAC name is (3S)-N-[2-(tert-butylamino)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(tert-butylamino)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97071735 |
| Molecular Formula | C14H26F3N3O |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | (3S)-N-[2-(tert-butylamino)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)NCCNC(=O)[C@H]1CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H26F3N3O/c1-13(2,3)19-7-6-18-12(21)11-5-4-8-20(9-11)10-14(15,16)17/h11,19H,4-10H2,1-3H3,(H,18,21)/t11-/m0/s1 |
| InChIKey | UOEFOSCYICULSY-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|