C15H27N3O2S2 — CID 97072899
1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]urea (PubChem CID 97072899) has the molecular formula C15H27N3O2S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]urea.
| Compound Name | 1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 97072899 |
| Molecular Formula | C15H27N3O2S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[2-[(R)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]urea |
| SMILES | CN(C)[C@@H](CNC(=O)NCC[S@@](=O)C(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C15H27N3O2S2/c1-15(2,3)22(20)10-8-16-14(19)17-11-12(18(4)5)13-7-6-9-21-13/h6-7,9,12H,8,10-11H2,1-5H3,(H2,16,17,19)/t12-,22+/m0/s1 |
| InChIKey | HBYRRXUQZSDPMU-AMXDTQDGSA-N |
| XLogP | 2.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |