C17H24ClN5 — CID 97072925
(3S)-N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-1-(3-chloro-2-pyridinyl)pyrrolidin-3-amine (PubChem CID 97072925) has the molecular formula C17H24ClN5 and a molecular weight of 333.87 g/mol. Its IUPAC name is (3S)-N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-1-(3-chloro-2-pyridinyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-1-(3-chloro-2-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 97072925 |
| Molecular Formula | C17H24ClN5 |
| Molecular Weight | 333.87 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (3S)-N-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-1-(3-chloro-2-pyridinyl)pyrrolidin-3-amine |
| SMILES | CC(C)(C)c1[nH]ncc1CN[C@H]1CCN(c2ncccc2Cl)C1 |
| InChI | InChI=1S/C17H24ClN5/c1-17(2,3)15-12(10-21-22-15)9-20-13-6-8-23(11-13)16-14(18)5-4-7-19-16/h4-5,7,10,13,20H,6,8-9,11H2,1-3H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | KBTDEPKZWDWQAY-ZDUSSCGKSA-N |
| XLogP | 3.12 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |