C17H19N5S — CID 97337761
(3S)-1-pyridin-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine (PubChem CID 97337761) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is (3S)-1-pyridin-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-pyridin-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 97337761 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (3S)-1-pyridin-2-yl-N-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methyl]pyrrolidin-3-amine |
| SMILES | c1ccc(N2CC[C@H](NCc3cn[nH]c3-c3cccs3)C2)nc1 |
| InChI | InChI=1S/C17H19N5S/c1-2-7-18-16(5-1)22-8-6-14(12-22)19-10-13-11-20-21-17(13)15-4-3-9-23-15/h1-5,7,9,11,14,19H,6,8,10,12H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | VEWKPQNTCKBTLP-AWEZNQCLSA-N |
| XLogP | 2.90 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |