C19H19FN4O — CID 97074678
(5R)-7-fluoro-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 97074678) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is (5R)-7-fluoro-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | (5R)-7-fluoro-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 97074678 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (5R)-7-fluoro-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | Fc1ccc2c(c1)[C@H](NCc1cccc(-c3ncn[nH]3)c1)CCCO2 |
| InChI | InChI=1S/C19H19FN4O/c20-15-6-7-18-16(10-15)17(5-2-8-25-18)21-11-13-3-1-4-14(9-13)19-22-12-23-24-19/h1,3-4,6-7,9-10,12,17,21H,2,5,8,11H2,(H,22,23,24)/t17-/m1/s1 |
| InChIKey | DCCUSLLQMFDLCS-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |