C13H16BrFN2O3 — CID 97076337
N-(5-bromo-3-fluoro-2-pyridinyl)-3-[[(2R)-oxolan-2-yl]methoxy]propanamide (PubChem CID 97076337) has the molecular formula C13H16BrFN2O3 and a molecular weight of 347.18 g/mol. Its IUPAC name is N-(5-bromo-3-fluoro-2-pyridinyl)-3-[[(2R)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | N-(5-bromo-3-fluoro-2-pyridinyl)-3-[[(2R)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 97076337 |
| Molecular Formula | C13H16BrFN2O3 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(5-bromo-3-fluoro-2-pyridinyl)-3-[[(2R)-oxolan-2-yl]methoxy]propanamide |
| SMILES | O=C(CCOC[C@H]1CCCO1)Nc1ncc(Br)cc1F |
| InChI | InChI=1S/C13H16BrFN2O3/c14-9-6-11(15)13(16-7-9)17-12(18)3-5-19-8-10-2-1-4-20-10/h6-7,10H,1-5,8H2,(H,16,17,18)/t10-/m1/s1 |
| InChIKey | FPMMNMANYPVYHT-SNVBAGLBSA-N |
| XLogP | 2.51 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|