C18H24N2O3S — CID 97077046
3-[[[2-[(R)-cyclopentylsulfinyl]acetyl]amino]methyl]-N-cyclopropylbenzamide (PubChem CID 97077046) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-[[[2-[(R)-cyclopentylsulfinyl]acetyl]amino]methyl]-N-cyclopropylbenzamide.
| Compound Name | 3-[[[2-[(R)-cyclopentylsulfinyl]acetyl]amino]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 97077046 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[[[2-[(R)-cyclopentylsulfinyl]acetyl]amino]methyl]-N-cyclopropylbenzamide |
| SMILES | O=C(C[S@@](=O)C1CCCC1)NCc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C18H24N2O3S/c21-17(12-24(23)16-6-1-2-7-16)19-11-13-4-3-5-14(10-13)18(22)20-15-8-9-15/h3-5,10,15-16H,1-2,6-9,11-12H2,(H,19,21)(H,20,22)/t24-/m1/s1 |
| InChIKey | SLZUNOIAEMJZPO-XMMPIXPASA-N |
| XLogP | 1.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |