C21H23FN2O2 — CID 91518477
N-cyclopropyl-3-[[4-(2-fluorophenyl)butanoylamino]methyl]benzamide (PubChem CID 91518477) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is N-cyclopropyl-3-[[4-(2-fluorophenyl)butanoylamino]methyl]benzamide.
| Compound Name | N-cyclopropyl-3-[[4-(2-fluorophenyl)butanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 91518477 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-cyclopropyl-3-[[4-(2-fluorophenyl)butanoylamino]methyl]benzamide |
| SMILES | O=C(CCCc1ccccc1F)NCc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C21H23FN2O2/c22-19-9-2-1-6-16(19)7-4-10-20(25)23-14-15-5-3-8-17(13-15)21(26)24-18-11-12-18/h1-3,5-6,8-9,13,18H,4,7,10-12,14H2,(H,23,25)(H,24,26) |
| InChIKey | NAROWUWGZRHNLA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |