C21H26FN3O2 — CID 75394264
N-[4-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylamino]-4-oxobutyl]benzamide (PubChem CID 75394264) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[4-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylamino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 75394264 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[4-[[4-[(dimethylamino)methyl]-3-fluorophenyl]methylamino]-4-oxobutyl]benzamide |
| SMILES | CN(C)Cc1ccc(CNC(=O)CCCNC(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C21H26FN3O2/c1-25(2)15-18-11-10-16(13-19(18)22)14-24-20(26)9-6-12-23-21(27)17-7-4-3-5-8-17/h3-5,7-8,10-11,13H,6,9,12,14-15H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | JFPWFBJZHYHGAT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|