C22H36N4O2 — CID 97078290
1-[(2R)-2-(azepan-1-yl)-3-methylbutyl]-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea (PubChem CID 97078290) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[(2R)-2-(azepan-1-yl)-3-methylbutyl]-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[(2R)-2-(azepan-1-yl)-3-methylbutyl]-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 97078290 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-[(2R)-2-(azepan-1-yl)-3-methylbutyl]-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea |
| SMILES | CC(C)[C@H](CNC(=O)NCc1ccc(OCC2CC2)nc1)N1CCCCCC1 |
| InChI | InChI=1S/C22H36N4O2/c1-17(2)20(26-11-5-3-4-6-12-26)15-25-22(27)24-14-19-9-10-21(23-13-19)28-16-18-7-8-18/h9-10,13,17-18,20H,3-8,11-12,14-16H2,1-2H3,(H2,24,25,27)/t20-/m0/s1 |
| InChIKey | CROSBTOWYXTFKK-FQEVSTJZSA-N |
| XLogP | 3.57 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |