C22H34N4O2 — CID 86904655
1-(1-cyclohexylpiperidin-3-yl)-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea (PubChem CID 86904655) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-(1-cyclohexylpiperidin-3-yl)-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1-(1-cyclohexylpiperidin-3-yl)-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 86904655 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-(1-cyclohexylpiperidin-3-yl)-3-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]urea |
| SMILES | O=C(NCc1ccc(OCC2CC2)nc1)NC1CCCN(C2CCCCC2)C1 |
| InChI | InChI=1S/C22H34N4O2/c27-22(24-14-18-10-11-21(23-13-18)28-16-17-8-9-17)25-19-5-4-12-26(15-19)20-6-2-1-3-7-20/h10-11,13,17,19-20H,1-9,12,14-16H2,(H2,24,25,27) |
| InChIKey | JCMONDUXQJYOAX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |