C16H24N2O2 — CID 97080771
methyl (2S)-2-[(3R)-3-(2-methylpropyl)pyrrolidin-1-yl]-2-pyridin-3-ylacetate (PubChem CID 97080771) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl (2S)-2-[(3R)-3-(2-methylpropyl)pyrrolidin-1-yl]-2-pyridin-3-ylacetate.
| Compound Name | methyl (2S)-2-[(3R)-3-(2-methylpropyl)pyrrolidin-1-yl]-2-pyridin-3-ylacetate |
|---|---|
| PubChem CID | 97080771 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | methyl (2S)-2-[(3R)-3-(2-methylpropyl)pyrrolidin-1-yl]-2-pyridin-3-ylacetate |
| SMILES | COC(=O)[C@H](c1cccnc1)N1CC[C@@H](CC(C)C)C1 |
| InChI | InChI=1S/C16H24N2O2/c1-12(2)9-13-6-8-18(11-13)15(16(19)20-3)14-5-4-7-17-10-14/h4-5,7,10,12-13,15H,6,8-9,11H2,1-3H3/t13-,15-/m0/s1 |
| InChIKey | GFJVMKGFQXSCRD-ZFWWWQNUSA-N |
| XLogP | 2.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |