About methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate
methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate (PubChem CID 97062459) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate.
Molecular Properties
| Compound Name | methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate |
| PubChem CID | 97062459 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate |
| SMILES | COC(=O)[C@H](c1cccnc1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C15H16N2O2S/c1-19-15(18)14(11-3-2-6-16-9-11)17-7-4-13-12(10-17)5-8-20-13/h2-3,5-6,8-9,14H,4,7,10H2,1H3/t14-/m0/s1 |
| InChIKey | AJSWBJOCOVVYTP-AWEZNQCLSA-N |
| XLogP | 2.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate?
The IUPAC name of methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate (CID 97062459) is methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate.
What is the SMILES notation for methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate?
The canonical SMILES for methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate is COC(=O)[C@H](c1cccnc1)N1CCc2sccc2C1.
What is the InChIKey of methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate?
The InChIKey is AJSWBJOCOVVYTP-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H16N2O2S/c1-19-15(18)14(11-3-2-6-16-9-11)17-7-4-13-12(10-17)5-8-20-13/h2-3,5-6,8-9,14H,4,7,10H2,1H3/t14-/m0/s1.
What are the key properties of methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate?
methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate has a molecular weight of 288.37 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-pyridin-3-ylacetate is sourced from PubChem (CID 97062459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).