C19H18N4O — CID 97081710
N-[(1S,2R)-2-phenylcyclobutyl]-4-pyrazol-1-ylpyridine-2-carboxamide (PubChem CID 97081710) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(1S,2R)-2-phenylcyclobutyl]-4-pyrazol-1-ylpyridine-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-phenylcyclobutyl]-4-pyrazol-1-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 97081710 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(1S,2R)-2-phenylcyclobutyl]-4-pyrazol-1-ylpyridine-2-carboxamide |
| SMILES | O=C(N[C@H]1CC[C@@H]1c1ccccc1)c1cc(-n2cccn2)ccn1 |
| InChI | InChI=1S/C19H18N4O/c24-19(18-13-15(9-11-20-18)23-12-4-10-21-23)22-17-8-7-16(17)14-5-2-1-3-6-14/h1-6,9-13,16-17H,7-8H2,(H,22,24)/t16-,17+/m1/s1 |
| InChIKey | XCUZCBHHFASPMJ-SJORKVTESA-N |
| XLogP | 2.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |