C19H27N3O6S — CID 97082374
benzyl N-[2-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]sulfonylethyl]carbamate (PubChem CID 97082374) has the molecular formula C19H27N3O6S and a molecular weight of 425.51 g/mol. Its IUPAC name is benzyl N-[2-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]sulfonylethyl]carbamate.
| Compound Name | benzyl N-[2-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]sulfonylethyl]carbamate |
|---|---|
| PubChem CID | 97082374 |
| Molecular Formula | C19H27N3O6S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | benzyl N-[2-[4-[(2R)-oxolane-2-carbonyl]piperazin-1-yl]sulfonylethyl]carbamate |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(C(=O)[C@H]2CCCO2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C19H27N3O6S/c23-18(17-7-4-13-27-17)21-9-11-22(12-10-21)29(25,26)14-8-20-19(24)28-15-16-5-2-1-3-6-16/h1-3,5-6,17H,4,7-15H2,(H,20,24)/t17-/m1/s1 |
| InChIKey | QGCGPRVWMOYGCZ-QGZVFWFLSA-N |
| XLogP | 0.57 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |