C12H14F3NO2S — CID 97082580
N-[2-[(R)-benzylsulfinyl]ethyl]-3,3,3-trifluoropropanamide (PubChem CID 97082580) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is N-[2-[(R)-benzylsulfinyl]ethyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[2-[(R)-benzylsulfinyl]ethyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 97082580 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | N-[2-[(R)-benzylsulfinyl]ethyl]-3,3,3-trifluoropropanamide |
| SMILES | O=C(CC(F)(F)F)NCC[S@](=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14F3NO2S/c13-12(14,15)8-11(17)16-6-7-19(18)9-10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17)/t19-/m0/s1 |
| InChIKey | ZMGQYYIQGPRTSZ-IBGZPJMESA-N |
| XLogP | 2.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |