C18H20N2O3S — CID 95770934
N-[2-[(S)-benzylsulfinyl]ethyl]-N'-(2-methylphenyl)oxamide (PubChem CID 95770934) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[2-[(S)-benzylsulfinyl]ethyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[2-[(S)-benzylsulfinyl]ethyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 95770934 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[2-[(S)-benzylsulfinyl]ethyl]-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCC[S@@](=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-14-7-5-6-10-16(14)20-18(22)17(21)19-11-12-24(23)13-15-8-3-2-4-9-15/h2-10H,11-13H2,1H3,(H,19,21)(H,20,22)/t24-/m1/s1 |
| InChIKey | UZDCBSGUIFSSKE-XMMPIXPASA-N |
| XLogP | 2.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|