C20H25N3O2 — CID 97082927
2-(cyclopropylmethoxy)-1-[(3S)-3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethanone (PubChem CID 97082927) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-1-[(3S)-3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(cyclopropylmethoxy)-1-[(3S)-3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 97082927 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(cyclopropylmethoxy)-1-[(3S)-3-(5-phenyl-1H-imidazol-2-yl)piperidin-1-yl]ethanone |
| SMILES | O=C(COCC1CC1)N1CCC[C@H](c2ncc(-c3ccccc3)[nH]2)C1 |
| InChI | InChI=1S/C20H25N3O2/c24-19(14-25-13-15-8-9-15)23-10-4-7-17(12-23)20-21-11-18(22-20)16-5-2-1-3-6-16/h1-3,5-6,11,15,17H,4,7-10,12-14H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | SLMZKQCFZXAVRB-KRWDZBQOSA-N |
| XLogP | 3.21 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |