C25H29N3O — CID 10157055
1-[3-[5-(4-phenylphenyl)-1H-imidazol-2-yl]piperidin-1-yl]pentan-1-one (PubChem CID 10157055) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[3-[5-(4-phenylphenyl)-1H-imidazol-2-yl]piperidin-1-yl]pentan-1-one.
| Compound Name | 1-[3-[5-(4-phenylphenyl)-1H-imidazol-2-yl]piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 10157055 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[3-[5-(4-phenylphenyl)-1H-imidazol-2-yl]piperidin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCCC(c2ncc(-c3ccc(-c4ccccc4)cc3)[nH]2)C1 |
| InChI | InChI=1S/C25H29N3O/c1-2-3-11-24(29)28-16-7-10-22(18-28)25-26-17-23(27-25)21-14-12-20(13-15-21)19-8-5-4-6-9-19/h4-6,8-9,12-15,17,22H,2-3,7,10-11,16,18H2,1H3,(H,26,27) |
| InChIKey | ZYUUDDBYJMZZBY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |