C20H29N3O3 — CID 160800300
4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]piperidine;pentanoic acid (PubChem CID 160800300) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]piperidine;pentanoic acid.
| Compound Name | 4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]piperidine;pentanoic acid |
|---|---|
| PubChem CID | 160800300 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1H-imidazol-2-yl]piperidine;pentanoic acid |
| SMILES | CCCCC(=O)O.COc1ccc(-c2cnc(C3CCNCC3)[nH]2)cc1 |
| InChI | InChI=1S/C15H19N3O.C5H10O2/c1-19-13-4-2-11(3-5-13)14-10-17-15(18-14)12-6-8-16-9-7-12;1-2-3-4-5(6)7/h2-5,10,12,16H,6-9H2,1H3,(H,17,18);2-4H2,1H3,(H,6,7) |
| InChIKey | SCZHJADCZGYCIM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |