C18H25N3O — CID 82463603
4-[2-(4-butoxyphenyl)-1H-imidazol-5-yl]piperidine (PubChem CID 82463603) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-[2-(4-butoxyphenyl)-1H-imidazol-5-yl]piperidine.
| Compound Name | 4-[2-(4-butoxyphenyl)-1H-imidazol-5-yl]piperidine |
|---|---|
| PubChem CID | 82463603 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 4-[2-(4-butoxyphenyl)-1H-imidazol-5-yl]piperidine |
| SMILES | CCCCOc1ccc(-c2ncc(C3CCNCC3)[nH]2)cc1 |
| InChI | InChI=1S/C18H25N3O/c1-2-3-12-22-16-6-4-15(5-7-16)18-20-13-17(21-18)14-8-10-19-11-9-14/h4-7,13-14,19H,2-3,8-12H2,1H3,(H,20,21) |
| InChIKey | NBOSMLLNSOSWAA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|