C13H15N3O3 — CID 175078221
6-(4-butoxyphenyl)-1H-1,3,5-triazine-2,4-dione (PubChem CID 175078221) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-(4-butoxyphenyl)-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-(4-butoxyphenyl)-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 175078221 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-(4-butoxyphenyl)-1H-1,3,5-triazine-2,4-dione |
| SMILES | CCCCOc1ccc(-c2nc(=O)[nH]c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C13H15N3O3/c1-2-3-8-19-10-6-4-9(5-7-10)11-14-12(17)16-13(18)15-11/h4-7H,2-3,8H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | RDLQEGNNGOPZBI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|