C16H16N4O3S — CID 176740819
4-(4-butoxyphenyl)-2-sulfanylidene-3,8-dihydropyrimido[4,5-d]pyrimidine-5,7-dione (PubChem CID 176740819) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-2-sulfanylidene-3,8-dihydropyrimido[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 4-(4-butoxyphenyl)-2-sulfanylidene-3,8-dihydropyrimido[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 176740819 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 4-(4-butoxyphenyl)-2-sulfanylidene-3,8-dihydropyrimido[4,5-d]pyrimidine-5,7-dione |
| SMILES | CCCCOc1ccc(-c2[nH]c(=S)nc3[nH]c(=O)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C16H16N4O3S/c1-2-3-8-23-10-6-4-9(5-7-10)12-11-13(19-16(24)17-12)18-15(22)20-14(11)21/h4-7H,2-3,8H2,1H3,(H3,17,18,19,20,21,22,24) |
| InChIKey | AUYRCJHFIMNFSG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|