C30H34N2O4 — CID 162196378
1,4-bis(4-hexoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 162196378) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 1,4-bis(4-hexoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis(4-hexoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 162196378 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1,4-bis(4-hexoxyphenyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCOc1ccc(-c2nc(=O)c3c(-c4ccc(OCCCCCC)cc4)nc(=O)c2=3)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-3-5-7-9-19-35-23-15-11-21(12-16-23)27-25-26(30(34)31-27)28(32-29(25)33)22-13-17-24(18-14-22)36-20-10-8-6-4-2/h11-18H,3-10,19-20H2,1-2H3 |
| InChIKey | ZQZLDISPSSNEMW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|