C30H32N6O2 — CID 118529706
5-(4-butoxyphenyl)-3-[3-[5-(4-butoxyphenyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole (PubChem CID 118529706) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-3-[3-[5-(4-butoxyphenyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole.
| Compound Name | 5-(4-butoxyphenyl)-3-[3-[5-(4-butoxyphenyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 118529706 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 5-(4-butoxyphenyl)-3-[3-[5-(4-butoxyphenyl)-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazole |
| SMILES | CCCCOc1ccc(-c2nc(-c3cccc(-c4n[nH]c(-c5ccc(OCCCC)cc5)n4)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C30H32N6O2/c1-3-5-18-37-25-14-10-21(11-15-25)27-31-29(35-33-27)23-8-7-9-24(20-23)30-32-28(34-36-30)22-12-16-26(17-13-22)38-19-6-4-2/h7-17,20H,3-6,18-19H2,1-2H3,(H,31,33,35)(H,32,34,36) |
| InChIKey | HJPYQRMHXQWWGG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|