C38H44N6O4 — CID 118529765
[4-[3-[3-[5-[4-(2-ethylhexanoyloxy)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]phenyl] 2-ethylhexanoate (PubChem CID 118529765) has the molecular formula C38H44N6O4 and a molecular weight of 648.81 g/mol. Its IUPAC name is [4-[3-[3-[5-[4-(2-ethylhexanoyloxy)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]phenyl] 2-ethylhexanoate.
| Compound Name | [4-[3-[3-[5-[4-(2-ethylhexanoyloxy)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]phenyl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 118529765 |
| Molecular Formula | C38H44N6O4 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | [4-[3-[3-[5-[4-(2-ethylhexanoyloxy)phenyl]-1H-1,2,4-triazol-3-yl]phenyl]-1H-1,2,4-triazol-5-yl]phenyl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1ccc(-c2nc(-c3cccc(-c4n[nH]c(-c5ccc(OC(=O)C(CC)CCCC)cc5)n4)c3)n[nH]2)cc1 |
| InChI | InChI=1S/C38H44N6O4/c1-5-9-12-25(7-3)37(45)47-31-20-16-27(17-21-31)33-39-35(43-41-33)29-14-11-15-30(24-29)36-40-34(42-44-36)28-18-22-32(23-19-28)48-38(46)26(8-4)13-10-6-2/h11,14-26H,5-10,12-13H2,1-4H3,(H,39,41,43)(H,40,42,44) |
| InChIKey | MIODRUHOLFDKJU-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|