C43H52BrN3O9 — CID 143551622
[4-[4-[4-(2-bromohexanoyloxy)-2-hydroxyphenyl]-6-[4-(2-ethylhexanoyloxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenyl] 2-ethylhexanoate (PubChem CID 143551622) has the molecular formula C43H52BrN3O9 and a molecular weight of 834.80 g/mol. Its IUPAC name is [4-[4-[4-(2-bromohexanoyloxy)-2-hydroxyphenyl]-6-[4-(2-ethylhexanoyloxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenyl] 2-ethylhexanoate.
| Compound Name | [4-[4-[4-(2-bromohexanoyloxy)-2-hydroxyphenyl]-6-[4-(2-ethylhexanoyloxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenyl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 143551622 |
| Molecular Formula | C43H52BrN3O9 |
| Molecular Weight | 834.80 g/mol |
| Exact Mass | 833.29 |
| IUPAC Name | [4-[4-[4-(2-bromohexanoyloxy)-2-hydroxyphenyl]-6-[4-(2-ethylhexanoyloxy)-2-hydroxyphenyl]-1,3,5-triazin-2-yl]-3-hydroxyphenyl] 2-ethylhexanoate |
| SMILES | CCCCC(Br)C(=O)Oc1ccc(-c2nc(-c3ccc(OC(=O)C(CC)CCCC)cc3O)nc(-c3ccc(OC(=O)C(CC)CCCC)cc3O)n2)c(O)c1 |
| InChI | InChI=1S/C43H52BrN3O9/c1-6-11-14-26(9-4)41(51)54-28-17-20-31(35(48)23-28)38-45-39(32-21-18-29(24-36(32)49)55-42(52)27(10-5)15-12-7-2)47-40(46-38)33-22-19-30(25-37(33)50)56-43(53)34(44)16-13-8-3/h17-27,34,48-50H,6-16H2,1-5H3 |
| InChIKey | ONNXWMMAOGHTGU-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.80 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|