C44H50N4O9 — CID 163551989
[4-[[2-[(4-acetyloxybenzoyl)amino]-6-[[4-(2-ethylhexanoyloxy)benzoyl]amino]-4-pyridinyl]carbamoyl]phenyl] 2-ethylhexanoate (PubChem CID 163551989) has the molecular formula C44H50N4O9 and a molecular weight of 778.90 g/mol. Its IUPAC name is [4-[[2-[(4-acetyloxybenzoyl)amino]-6-[[4-(2-ethylhexanoyloxy)benzoyl]amino]-4-pyridinyl]carbamoyl]phenyl] 2-ethylhexanoate.
| Compound Name | [4-[[2-[(4-acetyloxybenzoyl)amino]-6-[[4-(2-ethylhexanoyloxy)benzoyl]amino]-4-pyridinyl]carbamoyl]phenyl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 163551989 |
| Molecular Formula | C44H50N4O9 |
| Molecular Weight | 778.90 g/mol |
| Exact Mass | 778.36 |
| IUPAC Name | [4-[[2-[(4-acetyloxybenzoyl)amino]-6-[[4-(2-ethylhexanoyloxy)benzoyl]amino]-4-pyridinyl]carbamoyl]phenyl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1ccc(C(=O)Nc2cc(NC(=O)c3ccc(OC(C)=O)cc3)nc(NC(=O)c3ccc(OC(=O)C(CC)CCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C44H50N4O9/c1-6-10-12-29(8-3)43(53)56-36-22-16-31(17-23-36)40(50)45-34-26-38(47-41(51)32-14-20-35(21-15-32)55-28(5)49)46-39(27-34)48-42(52)33-18-24-37(25-19-33)57-44(54)30(9-4)13-11-7-2/h14-27,29-30H,6-13H2,1-5H3,(H3,45,46,47,48,50,51,52) |
| InChIKey | FJWFKNKNQOBAAZ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 179.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.90 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|