C41H48N6O6 — CID 53392656
[3,5-bis[[6-(2-ethylhexanoylamino)-2-pyridinyl]carbamoyl]phenyl] benzoate (PubChem CID 53392656) has the molecular formula C41H48N6O6 and a molecular weight of 720.87 g/mol. Its IUPAC name is [3,5-bis[[6-(2-ethylhexanoylamino)-2-pyridinyl]carbamoyl]phenyl] benzoate.
| Compound Name | [3,5-bis[[6-(2-ethylhexanoylamino)-2-pyridinyl]carbamoyl]phenyl] benzoate |
|---|---|
| PubChem CID | 53392656 |
| Molecular Formula | C41H48N6O6 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | [3,5-bis[[6-(2-ethylhexanoylamino)-2-pyridinyl]carbamoyl]phenyl] benzoate |
| SMILES | CCCCC(CC)C(=O)Nc1cccc(NC(=O)c2cc(OC(=O)c3ccccc3)cc(C(=O)Nc3cccc(NC(=O)C(CC)CCCC)n3)c2)n1 |
| InChI | InChI=1S/C41H48N6O6/c1-5-9-16-27(7-3)37(48)44-33-20-14-22-35(42-33)46-39(50)30-24-31(26-32(25-30)53-41(52)29-18-12-11-13-19-29)40(51)47-36-23-15-21-34(43-36)45-38(49)28(8-4)17-10-6-2/h11-15,18-28H,5-10,16-17H2,1-4H3,(H2,42,44,46,48,50)(H2,43,45,47,49,51) |
| InChIKey | JUBCSJHRFQSCHG-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 168.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|