C17H23F2NO4 — CID 97083129
(2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide (PubChem CID 97083129) has the molecular formula C17H23F2NO4 and a molecular weight of 343.37 g/mol. Its IUPAC name is (2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide.
| Compound Name | (2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 97083129 |
| Molecular Formula | C17H23F2NO4 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (2R)-N-[4-(2,4-difluorophenyl)oxan-4-yl]-2-(2-methoxyethoxy)propanamide |
| SMILES | COCCO[C@H](C)C(=O)NC1(c2ccc(F)cc2F)CCOCC1 |
| InChI | InChI=1S/C17H23F2NO4/c1-12(24-10-9-22-2)16(21)20-17(5-7-23-8-6-17)14-4-3-13(18)11-15(14)19/h3-4,11-12H,5-10H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | DXMSOXYOQJUJPS-GFCCVEGCSA-N |
| XLogP | 2.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|