C18H25FN2O2 — CID 97083981
2-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]-N-methyl-N-propan-2-ylacetamide (PubChem CID 97083981) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]-N-methyl-N-propan-2-ylacetamide.
| Compound Name | 2-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]-N-methyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 97083981 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-[(2R)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]-N-methyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C)C(=O)CN1CCC[C@@H]1CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN2O2/c1-13(2)20(3)18(23)12-21-10-4-5-16(21)11-17(22)14-6-8-15(19)9-7-14/h6-9,13,16H,4-5,10-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | PAGUGYWNFJTDLB-MRXNPFEDSA-N |
| XLogP | 2.73 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |